C10H16Cl2N2S — CID 107961596
N-[(2,5-dichlorothiophen-3-yl)methyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 107961596) has the molecular formula C10H16Cl2N2S and a molecular weight of 267.22 g/mol. Its IUPAC name is N-[(2,5-dichlorothiophen-3-yl)methyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[(2,5-dichlorothiophen-3-yl)methyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 107961596 |
| Molecular Formula | C10H16Cl2N2S |
| Molecular Weight | 267.22 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | N-[(2,5-dichlorothiophen-3-yl)methyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNCc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H16Cl2N2S/c1-14(2)5-3-4-13-7-8-6-9(11)15-10(8)12/h6,13H,3-5,7H2,1-2H3 |
| InChIKey | GQTOKJSJNDFKJY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|