C12H20Cl2N2S — CID 114021220
N'-[(2,5-dichlorothiophen-3-yl)methyl]-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine (PubChem CID 114021220) has the molecular formula C12H20Cl2N2S and a molecular weight of 295.28 g/mol. Its IUPAC name is N'-[(2,5-dichlorothiophen-3-yl)methyl]-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine.
| Compound Name | N'-[(2,5-dichlorothiophen-3-yl)methyl]-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114021220 |
| Molecular Formula | C12H20Cl2N2S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | N'-[(2,5-dichlorothiophen-3-yl)methyl]-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine |
| SMILES | CC(C)CNCCN(C)Cc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C12H20Cl2N2S/c1-9(2)7-15-4-5-16(3)8-10-6-11(13)17-12(10)14/h6,9,15H,4-5,7-8H2,1-3H3 |
| InChIKey | WZWIYFHYPOKFIL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|