C14H23Cl2NS — CID 65306195
6-(2,5-dichlorothiophen-3-yl)-N-(2-methylpropyl)hexan-1-amine (PubChem CID 65306195) has the molecular formula C14H23Cl2NS and a molecular weight of 308.32 g/mol. Its IUPAC name is 6-(2,5-dichlorothiophen-3-yl)-N-(2-methylpropyl)hexan-1-amine.
| Compound Name | 6-(2,5-dichlorothiophen-3-yl)-N-(2-methylpropyl)hexan-1-amine |
|---|---|
| PubChem CID | 65306195 |
| Molecular Formula | C14H23Cl2NS |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 6-(2,5-dichlorothiophen-3-yl)-N-(2-methylpropyl)hexan-1-amine |
| SMILES | CC(C)CNCCCCCCc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C14H23Cl2NS/c1-11(2)10-17-8-6-4-3-5-7-12-9-13(15)18-14(12)16/h9,11,17H,3-8,10H2,1-2H3 |
| InChIKey | MWJNHUDKVBVXRS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|