C16H23Cl4N — CID 105350446
N-(2-methylpropyl)-6-(2,3,4,6-tetrachlorophenyl)hexan-1-amine (PubChem CID 105350446) has the molecular formula C16H23Cl4N and a molecular weight of 371.18 g/mol. Its IUPAC name is N-(2-methylpropyl)-6-(2,3,4,6-tetrachlorophenyl)hexan-1-amine.
| Compound Name | N-(2-methylpropyl)-6-(2,3,4,6-tetrachlorophenyl)hexan-1-amine |
|---|---|
| PubChem CID | 105350446 |
| Molecular Formula | C16H23Cl4N |
| Molecular Weight | 371.18 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | N-(2-methylpropyl)-6-(2,3,4,6-tetrachlorophenyl)hexan-1-amine |
| SMILES | CC(C)CNCCCCCCc1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C16H23Cl4N/c1-11(2)10-21-8-6-4-3-5-7-12-13(17)9-14(18)16(20)15(12)19/h9,11,21H,3-8,10H2,1-2H3 |
| InChIKey | AOGAFACQHKMTEC-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.18 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|