C5H5Cl2NOS — CID 131048910
N-[(2,5-dichlorothiophen-3-yl)methyl]hydroxylamine (PubChem CID 131048910) has the molecular formula C5H5Cl2NOS and a molecular weight of 198.07 g/mol. Its IUPAC name is N-[(2,5-dichlorothiophen-3-yl)methyl]hydroxylamine.
| Compound Name | N-[(2,5-dichlorothiophen-3-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 131048910 |
| Molecular Formula | C5H5Cl2NOS |
| Molecular Weight | 198.07 g/mol |
| Exact Mass | 196.95 |
| IUPAC Name | N-[(2,5-dichlorothiophen-3-yl)methyl]hydroxylamine |
| SMILES | ONCc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C5H5Cl2NOS/c6-4-1-3(2-8-9)5(7)10-4/h1,8-9H,2H2 |
| InChIKey | KAEHMSUIFILNKQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.07 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|