C7H7Cl2NO2S — CID 130682625
N-[(2,5-dichlorothiophen-3-yl)methyl]-2-hydroxyacetamide (PubChem CID 130682625) has the molecular formula C7H7Cl2NO2S and a molecular weight of 240.11 g/mol. Its IUPAC name is N-[(2,5-dichlorothiophen-3-yl)methyl]-2-hydroxyacetamide.
| Compound Name | N-[(2,5-dichlorothiophen-3-yl)methyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 130682625 |
| Molecular Formula | C7H7Cl2NO2S |
| Molecular Weight | 240.11 g/mol |
| Exact Mass | 238.96 |
| IUPAC Name | N-[(2,5-dichlorothiophen-3-yl)methyl]-2-hydroxyacetamide |
| SMILES | O=C(CO)NCc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C7H7Cl2NO2S/c8-5-1-4(7(9)13-5)2-10-6(12)3-11/h1,11H,2-3H2,(H,10,12) |
| InChIKey | XVPPGTYNCLQCIM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.11 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |