C11H15Cl2NS — CID 107961487
N-[(2,5-dichlorothiophen-3-yl)methyl]cyclohexanamine (PubChem CID 107961487) has the molecular formula C11H15Cl2NS and a molecular weight of 264.22 g/mol. Its IUPAC name is N-[(2,5-dichlorothiophen-3-yl)methyl]cyclohexanamine.
| Compound Name | N-[(2,5-dichlorothiophen-3-yl)methyl]cyclohexanamine |
|---|---|
| PubChem CID | 107961487 |
| Molecular Formula | C11H15Cl2NS |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | N-[(2,5-dichlorothiophen-3-yl)methyl]cyclohexanamine |
| SMILES | Clc1cc(CNC2CCCCC2)c(Cl)s1 |
| InChI | InChI=1S/C11H15Cl2NS/c12-10-6-8(11(13)15-10)7-14-9-4-2-1-3-5-9/h6,9,14H,1-5,7H2 |
| InChIKey | GVAUYMRMKDKHEU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |