C12H14ClF2N — CID 82781872
N-[(4-chloro-2,5-difluorophenyl)methyl]cyclopentanamine (PubChem CID 82781872) has the molecular formula C12H14ClF2N and a molecular weight of 245.70 g/mol. Its IUPAC name is N-[(4-chloro-2,5-difluorophenyl)methyl]cyclopentanamine.
| Compound Name | N-[(4-chloro-2,5-difluorophenyl)methyl]cyclopentanamine |
|---|---|
| PubChem CID | 82781872 |
| Molecular Formula | C12H14ClF2N |
| Molecular Weight | 245.70 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | N-[(4-chloro-2,5-difluorophenyl)methyl]cyclopentanamine |
| SMILES | Fc1cc(CNC2CCCC2)c(F)cc1Cl |
| InChI | InChI=1S/C12H14ClF2N/c13-10-6-11(14)8(5-12(10)15)7-16-9-3-1-2-4-9/h5-6,9,16H,1-4,7H2 |
| InChIKey | FJSWIFPSOKPKKB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.70 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|