C12H15ClF2N2 — CID 113405315
N-[(4-chloro-2,5-difluorophenyl)methyl]-N'-cyclopropylethane-1,2-diamine (PubChem CID 113405315) has the molecular formula C12H15ClF2N2 and a molecular weight of 260.71 g/mol. Its IUPAC name is N-[(4-chloro-2,5-difluorophenyl)methyl]-N'-cyclopropylethane-1,2-diamine.
| Compound Name | N-[(4-chloro-2,5-difluorophenyl)methyl]-N'-cyclopropylethane-1,2-diamine |
|---|---|
| PubChem CID | 113405315 |
| Molecular Formula | C12H15ClF2N2 |
| Molecular Weight | 260.71 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | N-[(4-chloro-2,5-difluorophenyl)methyl]-N'-cyclopropylethane-1,2-diamine |
| SMILES | Fc1cc(CNCCNC2CC2)c(F)cc1Cl |
| InChI | InChI=1S/C12H15ClF2N2/c13-10-6-11(14)8(5-12(10)15)7-16-3-4-17-9-1-2-9/h5-6,9,16-17H,1-4,7H2 |
| InChIKey | GYZKIGKACQTTGO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.71 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|