C10H15BrN2O — CID 106852032
N-[(2-bromofuran-3-yl)methyl]-N'-cyclopropylethane-1,2-diamine (PubChem CID 106852032) has the molecular formula C10H15BrN2O and a molecular weight of 259.15 g/mol. Its IUPAC name is N-[(2-bromofuran-3-yl)methyl]-N'-cyclopropylethane-1,2-diamine.
| Compound Name | N-[(2-bromofuran-3-yl)methyl]-N'-cyclopropylethane-1,2-diamine |
|---|---|
| PubChem CID | 106852032 |
| Molecular Formula | C10H15BrN2O |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | N-[(2-bromofuran-3-yl)methyl]-N'-cyclopropylethane-1,2-diamine |
| SMILES | Brc1occc1CNCCNC1CC1 |
| InChI | InChI=1S/C10H15BrN2O/c11-10-8(3-6-14-10)7-12-4-5-13-9-1-2-9/h3,6,9,12-13H,1-2,4-5,7H2 |
| InChIKey | NADLHFCGZPNLTC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|