C12H16BrFN2 — CID 115619711
N-[(4-bromo-2-fluorophenyl)methyl]-N'-cyclopropylethane-1,2-diamine (PubChem CID 115619711) has the molecular formula C12H16BrFN2 and a molecular weight of 287.18 g/mol. Its IUPAC name is N-[(4-bromo-2-fluorophenyl)methyl]-N'-cyclopropylethane-1,2-diamine.
| Compound Name | N-[(4-bromo-2-fluorophenyl)methyl]-N'-cyclopropylethane-1,2-diamine |
|---|---|
| PubChem CID | 115619711 |
| Molecular Formula | C12H16BrFN2 |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | N-[(4-bromo-2-fluorophenyl)methyl]-N'-cyclopropylethane-1,2-diamine |
| SMILES | Fc1cc(Br)ccc1CNCCNC1CC1 |
| InChI | InChI=1S/C12H16BrFN2/c13-10-2-1-9(12(14)7-10)8-15-5-6-16-11-3-4-11/h1-2,7,11,15-16H,3-6,8H2 |
| InChIKey | JONUILWKCHCGPY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|