C13H21N3 — CID 106703541
N-[(2-aminophenyl)methyl]-N'-cyclopropylpropane-1,3-diamine (PubChem CID 106703541) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is N-[(2-aminophenyl)methyl]-N'-cyclopropylpropane-1,3-diamine.
| Compound Name | N-[(2-aminophenyl)methyl]-N'-cyclopropylpropane-1,3-diamine |
|---|---|
| PubChem CID | 106703541 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N-[(2-aminophenyl)methyl]-N'-cyclopropylpropane-1,3-diamine |
| SMILES | Nc1ccccc1CNCCCNC1CC1 |
| InChI | InChI=1S/C13H21N3/c14-13-5-2-1-4-11(13)10-15-8-3-9-16-12-6-7-12/h1-2,4-5,12,15-16H,3,6-10,14H2 |
| InChIKey | XOPLJBPJSFIJKF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|