C13H18Cl2N2 — CID 113410401
N'-cyclopropyl-N-[(2,6-dichlorophenyl)methyl]propane-1,3-diamine (PubChem CID 113410401) has the molecular formula C13H18Cl2N2 and a molecular weight of 273.21 g/mol. Its IUPAC name is N'-cyclopropyl-N-[(2,6-dichlorophenyl)methyl]propane-1,3-diamine.
| Compound Name | N'-cyclopropyl-N-[(2,6-dichlorophenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 113410401 |
| Molecular Formula | C13H18Cl2N2 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N'-cyclopropyl-N-[(2,6-dichlorophenyl)methyl]propane-1,3-diamine |
| SMILES | Clc1cccc(Cl)c1CNCCCNC1CC1 |
| InChI | InChI=1S/C13H18Cl2N2/c14-12-3-1-4-13(15)11(12)9-16-7-2-8-17-10-5-6-10/h1,3-4,10,16-17H,2,5-9H2 |
| InChIKey | QKOIFUJBTKOFAJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|