C9H11ClF2N2 — CID 163922038
N'-[(5-chloro-2,4-difluorophenyl)methyl]ethane-1,2-diamine (PubChem CID 163922038) has the molecular formula C9H11ClF2N2 and a molecular weight of 220.65 g/mol. Its IUPAC name is N'-[(5-chloro-2,4-difluorophenyl)methyl]ethane-1,2-diamine.
| Compound Name | N'-[(5-chloro-2,4-difluorophenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 163922038 |
| Molecular Formula | C9H11ClF2N2 |
| Molecular Weight | 220.65 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | N'-[(5-chloro-2,4-difluorophenyl)methyl]ethane-1,2-diamine |
| SMILES | NCCNCc1cc(Cl)c(F)cc1F |
| InChI | InChI=1S/C9H11ClF2N2/c10-7-3-6(5-14-2-1-13)8(11)4-9(7)12/h3-4,14H,1-2,5,13H2 |
| InChIKey | RBFMNJRHROUKNG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.65 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|