About (2R)-2-N-[(4-chloro-2,5-difluorophenyl)methyl]propane-1,2-diamine
(2R)-2-N-[(4-chloro-2,5-difluorophenyl)methyl]propane-1,2-diamine (PubChem CID 104867950) has the molecular formula C10H13ClF2N2
and a molecular weight of 234.68 g/mol. Its IUPAC name is (2R)-2-N-[(4-chloro-2,5-difluorophenyl)methyl]propane-1,2-diamine.
Molecular Properties
| Compound Name | (2R)-2-N-[(4-chloro-2,5-difluorophenyl)methyl]propane-1,2-diamine |
| PubChem CID | 104867950 |
| Molecular Formula | C10H13ClF2N2 |
| Molecular Weight | 234.68 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | (2R)-2-N-[(4-chloro-2,5-difluorophenyl)methyl]propane-1,2-diamine |
| SMILES | C[C@H](CN)NCc1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C10H13ClF2N2/c1-6(4-14)15-5-7-2-10(13)8(11)3-9(7)12/h2-3,6,15H,4-5,14H2,1H3/t6-/m1/s1 |
| InChIKey | SRJNQCKVQSZWLS-ZCFIWIBFSA-N |
| XLogP | 2.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.68 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-N-[(4-chloro-2,5-difluorophenyl)methyl]propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-N-[(4-chloro-2,5-difluorophenyl)methyl]propane-1,2-diamine?
The IUPAC name of (2R)-2-N-[(4-chloro-2,5-difluorophenyl)methyl]propane-1,2-diamine (CID 104867950) is (2R)-2-N-[(4-chloro-2,5-difluorophenyl)methyl]propane-1,2-diamine.
What is the SMILES notation for (2R)-2-N-[(4-chloro-2,5-difluorophenyl)methyl]propane-1,2-diamine?
The canonical SMILES for (2R)-2-N-[(4-chloro-2,5-difluorophenyl)methyl]propane-1,2-diamine is C[C@H](CN)NCc1cc(F)c(Cl)cc1F.
What is the InChIKey of (2R)-2-N-[(4-chloro-2,5-difluorophenyl)methyl]propane-1,2-diamine?
The InChIKey is SRJNQCKVQSZWLS-ZCFIWIBFSA-N. The full InChI is InChI=1S/C10H13ClF2N2/c1-6(4-14)15-5-7-2-10(13)8(11)3-9(7)12/h2-3,6,15H,4-5,14H2,1H3/t6-/m1/s1.
What are the key properties of (2R)-2-N-[(4-chloro-2,5-difluorophenyl)methyl]propane-1,2-diamine?
(2R)-2-N-[(4-chloro-2,5-difluorophenyl)methyl]propane-1,2-diamine has a molecular weight of 234.68 g/mol, XLogP of 2.06, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-N-[(4-chloro-2,5-difluorophenyl)methyl]propane-1,2-diamine is sourced from PubChem (CID 104867950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).