C10H14F2N2 — CID 104868144
(2R)-2-N-[(2,5-difluorophenyl)methyl]propane-1,2-diamine (PubChem CID 104868144) has the molecular formula C10H14F2N2 and a molecular weight of 200.23 g/mol. Its IUPAC name is (2R)-2-N-[(2,5-difluorophenyl)methyl]propane-1,2-diamine.
| Compound Name | (2R)-2-N-[(2,5-difluorophenyl)methyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 104868144 |
| Molecular Formula | C10H14F2N2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | (2R)-2-N-[(2,5-difluorophenyl)methyl]propane-1,2-diamine |
| SMILES | C[C@H](CN)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C10H14F2N2/c1-7(5-13)14-6-8-4-9(11)2-3-10(8)12/h2-4,7,14H,5-6,13H2,1H3/t7-/m1/s1 |
| InChIKey | OGICYRIHKWPJFI-SSDOTTSWSA-N |
| XLogP | 1.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |