C11H15F2N — CID 93284909
(2R)-N-[(2,5-difluorophenyl)methyl]butan-2-amine (PubChem CID 93284909) has the molecular formula C11H15F2N and a molecular weight of 199.24 g/mol. Its IUPAC name is (2R)-N-[(2,5-difluorophenyl)methyl]butan-2-amine.
| Compound Name | (2R)-N-[(2,5-difluorophenyl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 93284909 |
| Molecular Formula | C11H15F2N |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | (2R)-N-[(2,5-difluorophenyl)methyl]butan-2-amine |
| SMILES | CC[C@@H](C)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C11H15F2N/c1-3-8(2)14-7-9-6-10(12)4-5-11(9)13/h4-6,8,14H,3,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | KTVQCUMBQVUNQR-MRVPVSSYSA-N |
| XLogP | 2.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |