C15H17F2NO — CID 43312742
N-[(2,5-difluorophenyl)methyl]-4-(furan-2-yl)butan-2-amine (PubChem CID 43312742) has the molecular formula C15H17F2NO and a molecular weight of 265.30 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-4-(furan-2-yl)butan-2-amine.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-4-(furan-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 43312742 |
| Molecular Formula | C15H17F2NO |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-4-(furan-2-yl)butan-2-amine |
| SMILES | CC(CCc1ccco1)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C15H17F2NO/c1-11(4-6-14-3-2-8-19-14)18-10-12-9-13(16)5-7-15(12)17/h2-3,5,7-9,11,18H,4,6,10H2,1H3 |
| InChIKey | BUXWCTIZMDXOBM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |