C10H13F3N2 — CID 104868200
(2R)-2-N-[(2,4,6-trifluorophenyl)methyl]propane-1,2-diamine (PubChem CID 104868200) has the molecular formula C10H13F3N2 and a molecular weight of 218.22 g/mol. Its IUPAC name is (2R)-2-N-[(2,4,6-trifluorophenyl)methyl]propane-1,2-diamine.
| Compound Name | (2R)-2-N-[(2,4,6-trifluorophenyl)methyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 104868200 |
| Molecular Formula | C10H13F3N2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | (2R)-2-N-[(2,4,6-trifluorophenyl)methyl]propane-1,2-diamine |
| SMILES | C[C@H](CN)NCc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C10H13F3N2/c1-6(4-14)15-5-8-9(12)2-7(11)3-10(8)13/h2-3,6,15H,4-5,14H2,1H3/t6-/m1/s1 |
| InChIKey | NIPXLSPIUFQUOD-ZCFIWIBFSA-N |
| XLogP | 1.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |