C10H14Cl2N2 — CID 104868163
(2R)-2-N-[(3,5-dichlorophenyl)methyl]propane-1,2-diamine (PubChem CID 104868163) has the molecular formula C10H14Cl2N2 and a molecular weight of 233.14 g/mol. Its IUPAC name is (2R)-2-N-[(3,5-dichlorophenyl)methyl]propane-1,2-diamine.
| Compound Name | (2R)-2-N-[(3,5-dichlorophenyl)methyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 104868163 |
| Molecular Formula | C10H14Cl2N2 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | (2R)-2-N-[(3,5-dichlorophenyl)methyl]propane-1,2-diamine |
| SMILES | C[C@H](CN)NCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H14Cl2N2/c1-7(5-13)14-6-8-2-9(11)4-10(12)3-8/h2-4,7,14H,5-6,13H2,1H3/t7-/m1/s1 |
| InChIKey | KOVBONGLTIKFRF-SSDOTTSWSA-N |
| XLogP | 2.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |