C16H28N2O3 — CID 104868075
(2R)-2-N-[(3,4,5-triethoxyphenyl)methyl]propane-1,2-diamine (PubChem CID 104868075) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is (2R)-2-N-[(3,4,5-triethoxyphenyl)methyl]propane-1,2-diamine.
| Compound Name | (2R)-2-N-[(3,4,5-triethoxyphenyl)methyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 104868075 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | (2R)-2-N-[(3,4,5-triethoxyphenyl)methyl]propane-1,2-diamine |
| SMILES | CCOc1cc(CN[C@H](C)CN)cc(OCC)c1OCC |
| InChI | InChI=1S/C16H28N2O3/c1-5-19-14-8-13(11-18-12(4)10-17)9-15(20-6-2)16(14)21-7-3/h8-9,12,18H,5-7,10-11,17H2,1-4H3/t12-/m1/s1 |
| InChIKey | DHKHZUOXNJBRHR-GFCCVEGCSA-N |
| XLogP | 2.32 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |