C12H20N2O — CID 104868300
(2R)-2-N-[(2-ethoxyphenyl)methyl]propane-1,2-diamine (PubChem CID 104868300) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is (2R)-2-N-[(2-ethoxyphenyl)methyl]propane-1,2-diamine.
| Compound Name | (2R)-2-N-[(2-ethoxyphenyl)methyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 104868300 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | (2R)-2-N-[(2-ethoxyphenyl)methyl]propane-1,2-diamine |
| SMILES | CCOc1ccccc1CN[C@H](C)CN |
| InChI | InChI=1S/C12H20N2O/c1-3-15-12-7-5-4-6-11(12)9-14-10(2)8-13/h4-7,10,14H,3,8-9,13H2,1-2H3/t10-/m1/s1 |
| InChIKey | RQJWFXXIKATAJL-SNVBAGLBSA-N |
| XLogP | 1.52 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |