C10H15ClN2 — CID 104867783
(2S)-2-N-[(3-chlorophenyl)methyl]propane-1,2-diamine (PubChem CID 104867783) has the molecular formula C10H15ClN2 and a molecular weight of 198.70 g/mol. Its IUPAC name is (2S)-2-N-[(3-chlorophenyl)methyl]propane-1,2-diamine.
| Compound Name | (2S)-2-N-[(3-chlorophenyl)methyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 104867783 |
| Molecular Formula | C10H15ClN2 |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (2S)-2-N-[(3-chlorophenyl)methyl]propane-1,2-diamine |
| SMILES | C[C@@H](CN)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C10H15ClN2/c1-8(6-12)13-7-9-3-2-4-10(11)5-9/h2-5,8,13H,6-7,12H2,1H3/t8-/m0/s1 |
| InChIKey | YCXIGBFZLJRZAE-QMMMGPOBSA-N |
| XLogP | 1.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |