C13H19Cl2N — CID 106353845
1-chloro-N-[(3-chlorophenyl)methyl]-4-methylpentan-3-amine (PubChem CID 106353845) has the molecular formula C13H19Cl2N and a molecular weight of 260.21 g/mol. Its IUPAC name is 1-chloro-N-[(3-chlorophenyl)methyl]-4-methylpentan-3-amine.
| Compound Name | 1-chloro-N-[(3-chlorophenyl)methyl]-4-methylpentan-3-amine |
|---|---|
| PubChem CID | 106353845 |
| Molecular Formula | C13H19Cl2N |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 1-chloro-N-[(3-chlorophenyl)methyl]-4-methylpentan-3-amine |
| SMILES | CC(C)C(CCCl)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H19Cl2N/c1-10(2)13(6-7-14)16-9-11-4-3-5-12(15)8-11/h3-5,8,10,13,16H,6-7,9H2,1-2H3 |
| InChIKey | DWSIEXWRFKJYQN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|