C12H18ClN — CID 60819864
1-(3-chlorophenyl)-N,3-dimethylbutan-2-amine (PubChem CID 60819864) has the molecular formula C12H18ClN and a molecular weight of 211.74 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N,3-dimethylbutan-2-amine.
| Compound Name | 1-(3-chlorophenyl)-N,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 60819864 |
| Molecular Formula | C12H18ClN |
| Molecular Weight | 211.74 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 1-(3-chlorophenyl)-N,3-dimethylbutan-2-amine |
| SMILES | CNC(Cc1cccc(Cl)c1)C(C)C |
| InChI | InChI=1S/C12H18ClN/c1-9(2)12(14-3)8-10-5-4-6-11(13)7-10/h4-7,9,12,14H,8H2,1-3H3 |
| InChIKey | MZSPDJIXRAQAIK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.74 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |