C12H18F2N2 — CID 106345506
2-N-[(3,5-difluorophenyl)methyl]-3-methylbutane-1,2-diamine (PubChem CID 106345506) has the molecular formula C12H18F2N2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-N-[(3,5-difluorophenyl)methyl]-3-methylbutane-1,2-diamine.
| Compound Name | 2-N-[(3,5-difluorophenyl)methyl]-3-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 106345506 |
| Molecular Formula | C12H18F2N2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2-N-[(3,5-difluorophenyl)methyl]-3-methylbutane-1,2-diamine |
| SMILES | CC(C)C(CN)NCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H18F2N2/c1-8(2)12(6-15)16-7-9-3-10(13)5-11(14)4-9/h3-5,8,12,16H,6-7,15H2,1-2H3 |
| InChIKey | XNFATFXCIIRVPG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |