C12H13F2N3O — CID 107038987
3-[(4-cyano-2,6-difluorophenyl)methylamino]butanamide (PubChem CID 107038987) has the molecular formula C12H13F2N3O and a molecular weight of 253.25 g/mol. Its IUPAC name is 3-[(4-cyano-2,6-difluorophenyl)methylamino]butanamide.
| Compound Name | 3-[(4-cyano-2,6-difluorophenyl)methylamino]butanamide |
|---|---|
| PubChem CID | 107038987 |
| Molecular Formula | C12H13F2N3O |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 3-[(4-cyano-2,6-difluorophenyl)methylamino]butanamide |
| SMILES | CC(CC(N)=O)NCc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C12H13F2N3O/c1-7(2-12(16)18)17-6-9-10(13)3-8(5-15)4-11(9)14/h3-4,7,17H,2,6H2,1H3,(H2,16,18) |
| InChIKey | IAAUQJGIHHNEKQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |