C15H13F2N3 — CID 107037642
3,5-difluoro-4-[(1-pyridin-2-ylethylamino)methyl]benzonitrile (PubChem CID 107037642) has the molecular formula C15H13F2N3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 3,5-difluoro-4-[(1-pyridin-2-ylethylamino)methyl]benzonitrile.
| Compound Name | 3,5-difluoro-4-[(1-pyridin-2-ylethylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 107037642 |
| Molecular Formula | C15H13F2N3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 3,5-difluoro-4-[(1-pyridin-2-ylethylamino)methyl]benzonitrile |
| SMILES | CC(NCc1c(F)cc(C#N)cc1F)c1ccccn1 |
| InChI | InChI=1S/C15H13F2N3/c1-10(15-4-2-3-5-19-15)20-9-12-13(16)6-11(8-18)7-14(12)17/h2-7,10,20H,9H2,1H3 |
| InChIKey | KPXXJDIRGRFTTH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |