C17H22N2 — CID 43181287
1-pyridin-2-yl-N-[(2,4,6-trimethylphenyl)methyl]ethanamine (PubChem CID 43181287) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 1-pyridin-2-yl-N-[(2,4,6-trimethylphenyl)methyl]ethanamine.
| Compound Name | 1-pyridin-2-yl-N-[(2,4,6-trimethylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 43181287 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 1-pyridin-2-yl-N-[(2,4,6-trimethylphenyl)methyl]ethanamine |
| SMILES | Cc1cc(C)c(CNC(C)c2ccccn2)c(C)c1 |
| InChI | InChI=1S/C17H22N2/c1-12-9-13(2)16(14(3)10-12)11-19-15(4)17-7-5-6-8-18-17/h5-10,15,19H,11H2,1-4H3 |
| InChIKey | MKNXMRDFEQFUTI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |