C11H13Cl3N2O — CID 113250261
3-[(2,3,6-trichlorophenyl)methylamino]butanamide (PubChem CID 113250261) has the molecular formula C11H13Cl3N2O and a molecular weight of 295.60 g/mol. Its IUPAC name is 3-[(2,3,6-trichlorophenyl)methylamino]butanamide.
| Compound Name | 3-[(2,3,6-trichlorophenyl)methylamino]butanamide |
|---|---|
| PubChem CID | 113250261 |
| Molecular Formula | C11H13Cl3N2O |
| Molecular Weight | 295.60 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 3-[(2,3,6-trichlorophenyl)methylamino]butanamide |
| SMILES | CC(CC(N)=O)NCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C11H13Cl3N2O/c1-6(4-10(15)17)16-5-7-8(12)2-3-9(13)11(7)14/h2-3,6,16H,4-5H2,1H3,(H2,15,17) |
| InChIKey | STOGCVUYVJXZOZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|