C8H12ClN3OS — CID 104879366
3-[(5-chloro-1,3-thiazol-2-yl)methylamino]butanamide (PubChem CID 104879366) has the molecular formula C8H12ClN3OS and a molecular weight of 233.72 g/mol. Its IUPAC name is 3-[(5-chloro-1,3-thiazol-2-yl)methylamino]butanamide.
| Compound Name | 3-[(5-chloro-1,3-thiazol-2-yl)methylamino]butanamide |
|---|---|
| PubChem CID | 104879366 |
| Molecular Formula | C8H12ClN3OS |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 3-[(5-chloro-1,3-thiazol-2-yl)methylamino]butanamide |
| SMILES | CC(CC(N)=O)NCc1ncc(Cl)s1 |
| InChI | InChI=1S/C8H12ClN3OS/c1-5(2-7(10)13)11-4-8-12-3-6(9)14-8/h3,5,11H,2,4H2,1H3,(H2,10,13) |
| InChIKey | AIMBZLDQEVMTMY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |