C12H22N4OS — CID 115870437
3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]butanamide (PubChem CID 115870437) has the molecular formula C12H22N4OS and a molecular weight of 270.40 g/mol. Its IUPAC name is 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]butanamide.
| Compound Name | 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]butanamide |
|---|---|
| PubChem CID | 115870437 |
| Molecular Formula | C12H22N4OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]butanamide |
| SMILES | CCN(CC)c1ncc(CNC(C)CC(N)=O)s1 |
| InChI | InChI=1S/C12H22N4OS/c1-4-16(5-2)12-15-8-10(18-12)7-14-9(3)6-11(13)17/h8-9,14H,4-7H2,1-3H3,(H2,13,17) |
| InChIKey | WIGIMZNVQPWWGL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |