C6H8ClN3OS — CID 107124450
(3S)-3-amino-3-(5-chloro-1,3-thiazol-2-yl)propanamide (PubChem CID 107124450) has the molecular formula C6H8ClN3OS and a molecular weight of 205.67 g/mol. Its IUPAC name is (3S)-3-amino-3-(5-chloro-1,3-thiazol-2-yl)propanamide.
| Compound Name | (3S)-3-amino-3-(5-chloro-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 107124450 |
| Molecular Formula | C6H8ClN3OS |
| Molecular Weight | 205.67 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | (3S)-3-amino-3-(5-chloro-1,3-thiazol-2-yl)propanamide |
| SMILES | NC(=O)C[C@H](N)c1ncc(Cl)s1 |
| InChI | InChI=1S/C6H8ClN3OS/c7-4-2-10-6(12-4)3(8)1-5(9)11/h2-3H,1,8H2,(H2,9,11)/t3-/m0/s1 |
| InChIKey | CYFJXFVPHSXBAN-VKHMYHEASA-N |
| XLogP | 0.67 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.67 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |