C7H8BrClN2OS — CID 102841382
(3R)-3-amino-3-(4-bromo-5-chlorothiophen-2-yl)propanamide (PubChem CID 102841382) has the molecular formula C7H8BrClN2OS and a molecular weight of 283.58 g/mol. Its IUPAC name is (3R)-3-amino-3-(4-bromo-5-chlorothiophen-2-yl)propanamide.
| Compound Name | (3R)-3-amino-3-(4-bromo-5-chlorothiophen-2-yl)propanamide |
|---|---|
| PubChem CID | 102841382 |
| Molecular Formula | C7H8BrClN2OS |
| Molecular Weight | 283.58 g/mol |
| Exact Mass | 281.92 |
| IUPAC Name | (3R)-3-amino-3-(4-bromo-5-chlorothiophen-2-yl)propanamide |
| SMILES | NC(=O)C[C@@H](N)c1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C7H8BrClN2OS/c8-3-1-5(13-7(3)9)4(10)2-6(11)12/h1,4H,2,10H2,(H2,11,12)/t4-/m1/s1 |
| InChIKey | IVACEXZSSGNYMR-SCSAIBSYSA-N |
| XLogP | 2.04 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.58 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |