C11H17ClN2OS — CID 102764308
6-amino-6-(5-chloro-4-methylthiophen-2-yl)hexanamide (PubChem CID 102764308) has the molecular formula C11H17ClN2OS and a molecular weight of 260.79 g/mol. Its IUPAC name is 6-amino-6-(5-chloro-4-methylthiophen-2-yl)hexanamide.
| Compound Name | 6-amino-6-(5-chloro-4-methylthiophen-2-yl)hexanamide |
|---|---|
| PubChem CID | 102764308 |
| Molecular Formula | C11H17ClN2OS |
| Molecular Weight | 260.79 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 6-amino-6-(5-chloro-4-methylthiophen-2-yl)hexanamide |
| SMILES | Cc1cc(C(N)CCCCC(N)=O)sc1Cl |
| InChI | InChI=1S/C11H17ClN2OS/c1-7-6-9(16-11(7)12)8(13)4-2-3-5-10(14)15/h6,8H,2-5,13H2,1H3,(H2,14,15) |
| InChIKey | CXTIGPHTMWZUAF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.79 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|