C9H12ClNO2S — CID 84796674
4-amino-4-(4-chloro-5-methylthiophen-2-yl)butanoic acid (PubChem CID 84796674) has the molecular formula C9H12ClNO2S and a molecular weight of 233.72 g/mol. Its IUPAC name is 4-amino-4-(4-chloro-5-methylthiophen-2-yl)butanoic acid.
| Compound Name | 4-amino-4-(4-chloro-5-methylthiophen-2-yl)butanoic acid |
|---|---|
| PubChem CID | 84796674 |
| Molecular Formula | C9H12ClNO2S |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 4-amino-4-(4-chloro-5-methylthiophen-2-yl)butanoic acid |
| SMILES | Cc1sc(C(N)CCC(=O)O)cc1Cl |
| InChI | InChI=1S/C9H12ClNO2S/c1-5-6(10)4-8(14-5)7(11)2-3-9(12)13/h4,7H,2-3,11H2,1H3,(H,12,13) |
| InChIKey | VDUQGRCXXNFQTF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |