C9H12Cl2N2OS — CID 60860350
5-amino-5-(2,5-dichlorothiophen-3-yl)pentanamide (PubChem CID 60860350) has the molecular formula C9H12Cl2N2OS and a molecular weight of 267.18 g/mol. Its IUPAC name is 5-amino-5-(2,5-dichlorothiophen-3-yl)pentanamide.
| Compound Name | 5-amino-5-(2,5-dichlorothiophen-3-yl)pentanamide |
|---|---|
| PubChem CID | 60860350 |
| Molecular Formula | C9H12Cl2N2OS |
| Molecular Weight | 267.18 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | 5-amino-5-(2,5-dichlorothiophen-3-yl)pentanamide |
| SMILES | NC(=O)CCCC(N)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C9H12Cl2N2OS/c10-7-4-5(9(11)15-7)6(12)2-1-3-8(13)14/h4,6H,1-3,12H2,(H2,13,14) |
| InChIKey | DWIAPDVUHBTJMO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.18 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |