C6H4Cl3NOS — CID 130673602
2-chloro-2-(2,5-dichlorothiophen-3-yl)acetamide (PubChem CID 130673602) has the molecular formula C6H4Cl3NOS and a molecular weight of 244.53 g/mol. Its IUPAC name is 2-chloro-2-(2,5-dichlorothiophen-3-yl)acetamide.
| Compound Name | 2-chloro-2-(2,5-dichlorothiophen-3-yl)acetamide |
|---|---|
| PubChem CID | 130673602 |
| Molecular Formula | C6H4Cl3NOS |
| Molecular Weight | 244.53 g/mol |
| Exact Mass | 242.91 |
| IUPAC Name | 2-chloro-2-(2,5-dichlorothiophen-3-yl)acetamide |
| SMILES | NC(=O)C(Cl)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C6H4Cl3NOS/c7-3-1-2(5(9)12-3)4(8)6(10)11/h1,4H,(H2,10,11) |
| InChIKey | VFEDXPMPPFVOLB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|