C7H6Cl3NOS — CID 130649464
2-chloro-2-(2,5-dichlorothiophen-3-yl)-N-methylacetamide (PubChem CID 130649464) has the molecular formula C7H6Cl3NOS and a molecular weight of 258.56 g/mol. Its IUPAC name is 2-chloro-2-(2,5-dichlorothiophen-3-yl)-N-methylacetamide.
| Compound Name | 2-chloro-2-(2,5-dichlorothiophen-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 130649464 |
| Molecular Formula | C7H6Cl3NOS |
| Molecular Weight | 258.56 g/mol |
| Exact Mass | 256.92 |
| IUPAC Name | 2-chloro-2-(2,5-dichlorothiophen-3-yl)-N-methylacetamide |
| SMILES | CNC(=O)C(Cl)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C7H6Cl3NOS/c1-11-7(12)5(9)3-2-4(8)13-6(3)10/h2,5H,1H3,(H,11,12) |
| InChIKey | YPQOZFBJKRRNJX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|