C9H8ClF2NO — CID 63669080
2-chloro-2-(2,3-difluorophenyl)-N-methylacetamide (PubChem CID 63669080) has the molecular formula C9H8ClF2NO and a molecular weight of 219.62 g/mol. Its IUPAC name is 2-chloro-2-(2,3-difluorophenyl)-N-methylacetamide.
| Compound Name | 2-chloro-2-(2,3-difluorophenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 63669080 |
| Molecular Formula | C9H8ClF2NO |
| Molecular Weight | 219.62 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 2-chloro-2-(2,3-difluorophenyl)-N-methylacetamide |
| SMILES | CNC(=O)C(Cl)c1cccc(F)c1F |
| InChI | InChI=1S/C9H8ClF2NO/c1-13-9(14)7(10)5-3-2-4-6(11)8(5)12/h2-4,7H,1H3,(H,13,14) |
| InChIKey | HMSZIJHGIQHONU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.62 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|