C15H22F2N2O — CID 103878479
N-tert-butyl-2-[1-(2,3-difluorophenyl)ethylamino]propanamide (PubChem CID 103878479) has the molecular formula C15H22F2N2O and a molecular weight of 284.35 g/mol. Its IUPAC name is N-tert-butyl-2-[1-(2,3-difluorophenyl)ethylamino]propanamide.
| Compound Name | N-tert-butyl-2-[1-(2,3-difluorophenyl)ethylamino]propanamide |
|---|---|
| PubChem CID | 103878479 |
| Molecular Formula | C15H22F2N2O |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | N-tert-butyl-2-[1-(2,3-difluorophenyl)ethylamino]propanamide |
| SMILES | CC(NC(C)c1cccc(F)c1F)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H22F2N2O/c1-9(11-7-6-8-12(16)13(11)17)18-10(2)14(20)19-15(3,4)5/h6-10,18H,1-5H3,(H,19,20) |
| InChIKey | CZWXERAOLZREAJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |