C16H26N2OS — CID 115581036
N-tert-butyl-2-[1-(4-methylsulfanylphenyl)ethylamino]propanamide (PubChem CID 115581036) has the molecular formula C16H26N2OS and a molecular weight of 294.46 g/mol. Its IUPAC name is N-tert-butyl-2-[1-(4-methylsulfanylphenyl)ethylamino]propanamide.
| Compound Name | N-tert-butyl-2-[1-(4-methylsulfanylphenyl)ethylamino]propanamide |
|---|---|
| PubChem CID | 115581036 |
| Molecular Formula | C16H26N2OS |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | N-tert-butyl-2-[1-(4-methylsulfanylphenyl)ethylamino]propanamide |
| SMILES | CSc1ccc(C(C)NC(C)C(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H26N2OS/c1-11(13-7-9-14(20-6)10-8-13)17-12(2)15(19)18-16(3,4)5/h7-12,17H,1-6H3,(H,18,19) |
| InChIKey | RSXAECQAPGLBDT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |