C14H21F2NO — CID 103924841
4-[1-(2,3-difluorophenyl)ethylamino]-3,3-dimethylbutan-1-ol (PubChem CID 103924841) has the molecular formula C14H21F2NO and a molecular weight of 257.32 g/mol. Its IUPAC name is 4-[1-(2,3-difluorophenyl)ethylamino]-3,3-dimethylbutan-1-ol.
| Compound Name | 4-[1-(2,3-difluorophenyl)ethylamino]-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 103924841 |
| Molecular Formula | C14H21F2NO |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 4-[1-(2,3-difluorophenyl)ethylamino]-3,3-dimethylbutan-1-ol |
| SMILES | CC(NCC(C)(C)CCO)c1cccc(F)c1F |
| InChI | InChI=1S/C14H21F2NO/c1-10(17-9-14(2,3)7-8-18)11-5-4-6-12(15)13(11)16/h4-6,10,17-18H,7-9H2,1-3H3 |
| InChIKey | CXURRCXSAQBPCL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |