C16H27NO3 — CID 103787619
4-[1-(2,4-dimethoxyphenyl)ethylamino]-3,3-dimethylbutan-1-ol (PubChem CID 103787619) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 4-[1-(2,4-dimethoxyphenyl)ethylamino]-3,3-dimethylbutan-1-ol.
| Compound Name | 4-[1-(2,4-dimethoxyphenyl)ethylamino]-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 103787619 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 4-[1-(2,4-dimethoxyphenyl)ethylamino]-3,3-dimethylbutan-1-ol |
| SMILES | COc1ccc(C(C)NCC(C)(C)CCO)c(OC)c1 |
| InChI | InChI=1S/C16H27NO3/c1-12(17-11-16(2,3)8-9-18)14-7-6-13(19-4)10-15(14)20-5/h6-7,10,12,17-18H,8-9,11H2,1-5H3 |
| InChIKey | SDVRBLZKOPIIES-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |