C11H13F2N — CID 105005147
1-(2,3-difluorophenyl)-N,2-dimethylprop-2-en-1-amine (PubChem CID 105005147) has the molecular formula C11H13F2N and a molecular weight of 197.23 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-N,2-dimethylprop-2-en-1-amine.
| Compound Name | 1-(2,3-difluorophenyl)-N,2-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 105005147 |
| Molecular Formula | C11H13F2N |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 1-(2,3-difluorophenyl)-N,2-dimethylprop-2-en-1-amine |
| SMILES | C=C(C)C(NC)c1cccc(F)c1F |
| InChI | InChI=1S/C11H13F2N/c1-7(2)11(14-3)8-5-4-6-9(12)10(8)13/h4-6,11,14H,1H2,2-3H3 |
| InChIKey | QWQPCZITACFUAE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|