C10H10F2O — CID 79190349
1-(2,3-difluorophenyl)-2-methylprop-2-en-1-ol (PubChem CID 79190349) has the molecular formula C10H10F2O and a molecular weight of 184.18 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-2-methylprop-2-en-1-ol.
| Compound Name | 1-(2,3-difluorophenyl)-2-methylprop-2-en-1-ol |
|---|---|
| PubChem CID | 79190349 |
| Molecular Formula | C10H10F2O |
| Molecular Weight | 184.18 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1-(2,3-difluorophenyl)-2-methylprop-2-en-1-ol |
| SMILES | C=C(C)C(O)c1cccc(F)c1F |
| InChI | InChI=1S/C10H10F2O/c1-6(2)10(13)7-4-3-5-8(11)9(7)12/h3-5,10,13H,1H2,2H3 |
| InChIKey | FDCPGXXQXBXLPR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|