C12H16FN — CID 79189960
1-(4-fluoro-3-methylphenyl)-N,2-dimethylprop-2-en-1-amine (PubChem CID 79189960) has the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. Its IUPAC name is 1-(4-fluoro-3-methylphenyl)-N,2-dimethylprop-2-en-1-amine.
| Compound Name | 1-(4-fluoro-3-methylphenyl)-N,2-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 79189960 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 1-(4-fluoro-3-methylphenyl)-N,2-dimethylprop-2-en-1-amine |
| SMILES | C=C(C)C(NC)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C12H16FN/c1-8(2)12(14-4)10-5-6-11(13)9(3)7-10/h5-7,12,14H,1H2,2-4H3 |
| InChIKey | OQDMOQCXRRJXGT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|