C11H13ClFN — CID 107994087
1-(4-chloro-3-fluorophenyl)-N,2-dimethylprop-2-en-1-amine (PubChem CID 107994087) has the molecular formula C11H13ClFN and a molecular weight of 213.68 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-N,2-dimethylprop-2-en-1-amine.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-N,2-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 107994087 |
| Molecular Formula | C11H13ClFN |
| Molecular Weight | 213.68 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-N,2-dimethylprop-2-en-1-amine |
| SMILES | C=C(C)C(NC)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C11H13ClFN/c1-7(2)11(14-3)8-4-5-9(12)10(13)6-8/h4-6,11,14H,1H2,2-3H3 |
| InChIKey | UYGSAOJFMDBWQY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.68 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|