C12H14F3N — CID 105005111
N,2-dimethyl-1-[4-(trifluoromethyl)phenyl]prop-2-en-1-amine (PubChem CID 105005111) has the molecular formula C12H14F3N and a molecular weight of 229.24 g/mol. Its IUPAC name is N,2-dimethyl-1-[4-(trifluoromethyl)phenyl]prop-2-en-1-amine.
| Compound Name | N,2-dimethyl-1-[4-(trifluoromethyl)phenyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 105005111 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N,2-dimethyl-1-[4-(trifluoromethyl)phenyl]prop-2-en-1-amine |
| SMILES | C=C(C)C(NC)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H14F3N/c1-8(2)11(16-3)9-4-6-10(7-5-9)12(13,14)15/h4-7,11,16H,1H2,2-3H3 |
| InChIKey | WMYLJXVGEYVFAJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|