C9H13N3 — CID 105163770
N,2-dimethyl-1-pyridazin-4-ylprop-2-en-1-amine (PubChem CID 105163770) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is N,2-dimethyl-1-pyridazin-4-ylprop-2-en-1-amine.
| Compound Name | N,2-dimethyl-1-pyridazin-4-ylprop-2-en-1-amine |
|---|---|
| PubChem CID | 105163770 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | N,2-dimethyl-1-pyridazin-4-ylprop-2-en-1-amine |
| SMILES | C=C(C)C(NC)c1ccnnc1 |
| InChI | InChI=1S/C9H13N3/c1-7(2)9(10-3)8-4-5-11-12-6-8/h4-6,9-10H,1H2,2-3H3 |
| InChIKey | UPWDBCMIJQAYJG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|